C20H19F3N2OS — CID 130455005
3-(5-methylthiophen-2-yl)-1-[4-[2-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-yn-1-one (PubChem CID 130455005) has the molecular formula C20H19F3N2OS and a molecular weight of 392.45 g/mol. Its IUPAC name is 3-(5-methylthiophen-2-yl)-1-[4-[2-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-yn-1-one.
| Compound Name | 3-(5-methylthiophen-2-yl)-1-[4-[2-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 130455005 |
| Molecular Formula | C20H19F3N2OS |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-(5-methylthiophen-2-yl)-1-[4-[2-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-yn-1-one |
| SMILES | Cc1ccc(C#CC(=O)N2CCN(c3cc(C(F)(F)F)ccc3C)CC2)s1 |
| InChI | InChI=1S/C20H19F3N2OS/c1-14-3-5-16(20(21,22)23)13-18(14)24-9-11-25(12-10-24)19(26)8-7-17-6-4-15(2)27-17/h3-6,13H,9-12H2,1-2H3 |
| InChIKey | LHRJXPJXMUVCHE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|