C21H18ClF3N2O — CID 130454958
1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-yn-1-one (PubChem CID 130454958) has the molecular formula C21H18ClF3N2O and a molecular weight of 406.84 g/mol. Its IUPAC name is 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-yn-1-one.
| Compound Name | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 130454958 |
| Molecular Formula | C21H18ClF3N2O |
| Molecular Weight | 406.84 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-yn-1-one |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C(=O)C#Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H18ClF3N2O/c1-15-5-7-18(22)14-19(15)26-9-11-27(12-10-26)20(28)8-6-16-3-2-4-17(13-16)21(23,24)25/h2-5,7,13-14H,9-12H2,1H3 |
| InChIKey | IGTJRKBSGOVXST-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|