C22H23F3N2OS — CID 137436729
[4-[2-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]-[(1S)-2-(4-sulfanylphenyl)cyclopropyl]methanone (PubChem CID 137436729) has the molecular formula C22H23F3N2OS and a molecular weight of 420.50 g/mol. Its IUPAC name is [4-[2-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]-[(1S)-2-(4-sulfanylphenyl)cyclopropyl]methanone.
| Compound Name | [4-[2-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]-[(1S)-2-(4-sulfanylphenyl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 137436729 |
| Molecular Formula | C22H23F3N2OS |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [4-[2-methyl-5-(trifluoromethyl)phenyl]piperazin-1-yl]-[(1S)-2-(4-sulfanylphenyl)cyclopropyl]methanone |
| SMILES | Cc1ccc(C(F)(F)F)cc1N1CCN(C(=O)[C@H]2CC2c2ccc(S)cc2)CC1 |
| InChI | InChI=1S/C22H23F3N2OS/c1-14-2-5-16(22(23,24)25)12-20(14)26-8-10-27(11-9-26)21(28)19-13-18(19)15-3-6-17(29)7-4-15/h2-7,12,18-19,29H,8-11,13H2,1H3/t18?,19-/m0/s1 |
| InChIKey | BYXTYYITJAPBTH-GGYWPGCISA-N |
| XLogP | 4.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|