C20H25F3N2O2 — CID 137436694
[4-(oxan-4-yl)piperazin-1-yl]-[(2R)-2-[4-(trifluoromethyl)phenyl]cyclopropyl]methanone (PubChem CID 137436694) has the molecular formula C20H25F3N2O2 and a molecular weight of 382.43 g/mol. Its IUPAC name is [4-(oxan-4-yl)piperazin-1-yl]-[(2R)-2-[4-(trifluoromethyl)phenyl]cyclopropyl]methanone.
| Compound Name | [4-(oxan-4-yl)piperazin-1-yl]-[(2R)-2-[4-(trifluoromethyl)phenyl]cyclopropyl]methanone |
|---|---|
| PubChem CID | 137436694 |
| Molecular Formula | C20H25F3N2O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [4-(oxan-4-yl)piperazin-1-yl]-[(2R)-2-[4-(trifluoromethyl)phenyl]cyclopropyl]methanone |
| SMILES | O=C(C1C[C@H]1c1ccc(C(F)(F)F)cc1)N1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C20H25F3N2O2/c21-20(22,23)15-3-1-14(2-4-15)17-13-18(17)19(26)25-9-7-24(8-10-25)16-5-11-27-12-6-16/h1-4,16-18H,5-13H2/t17-,18?/m0/s1 |
| InChIKey | VQPROJASGGINCZ-ZENAZSQFSA-N |
| XLogP | 3.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |