C12H15ClF3N3S — CID 174875356
S-[[4-[2-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]thiohydroxylamine (PubChem CID 174875356) has the molecular formula C12H15ClF3N3S and a molecular weight of 325.79 g/mol. Its IUPAC name is S-[[4-[2-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]thiohydroxylamine.
| Compound Name | S-[[4-[2-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]thiohydroxylamine |
|---|---|
| PubChem CID | 174875356 |
| Molecular Formula | C12H15ClF3N3S |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | S-[[4-[2-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]thiohydroxylamine |
| SMILES | NSCN1CCN(c2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C12H15ClF3N3S/c13-10-2-1-9(12(14,15)16)7-11(10)19-5-3-18(4-6-19)8-20-17/h1-2,7H,3-6,8,17H2 |
| InChIKey | WZUSGOWEPMNCEW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|