C23H31N3O7 — CID 132514335
tert-butyl N-[3,3-dimethyl-1-oxo-5-(3,4,5-trimethoxyphenyl)-2,5-dihydropyrazolo[1,2-a]pyrazole-6-carbonyl]carbamate (PubChem CID 132514335) has the molecular formula C23H31N3O7 and a molecular weight of 461.52 g/mol. Its IUPAC name is tert-butyl N-[3,3-dimethyl-1-oxo-5-(3,4,5-trimethoxyphenyl)-2,5-dihydropyrazolo[1,2-a]pyrazole-6-carbonyl]carbamate.
| Compound Name | tert-butyl N-[3,3-dimethyl-1-oxo-5-(3,4,5-trimethoxyphenyl)-2,5-dihydropyrazolo[1,2-a]pyrazole-6-carbonyl]carbamate |
|---|---|
| PubChem CID | 132514335 |
| Molecular Formula | C23H31N3O7 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | tert-butyl N-[3,3-dimethyl-1-oxo-5-(3,4,5-trimethoxyphenyl)-2,5-dihydropyrazolo[1,2-a]pyrazole-6-carbonyl]carbamate |
| SMILES | COc1cc(C2C(C(=O)NC(=O)OC(C)(C)C)=CN3C(=O)CC(C)(C)N23)cc(OC)c1OC |
| InChI | InChI=1S/C23H31N3O7/c1-22(2,3)33-21(29)24-20(28)14-12-25-17(27)11-23(4,5)26(25)18(14)13-9-15(30-6)19(32-8)16(10-13)31-7/h9-10,12,18H,11H2,1-8H3,(H,24,28,29) |
| InChIKey | KIRQGYOITQJZMX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |