About 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid
2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid (PubChem CID 132516457) has the molecular formula C13H13NO8
and a molecular weight of 311.25 g/mol. Its IUPAC name is 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid.
Molecular Properties
| Compound Name | 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid |
| PubChem CID | 132516457 |
| Molecular Formula | C13H13NO8 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid |
| SMILES | CC(C(=O)O)(C(=O)O)c1cccc(C(C)(C(=O)O)C(=O)O)n1 |
| InChI | InChI=1S/C13H13NO8/c1-12(8(15)16,9(17)18)6-4-3-5-7(14-6)13(2,10(19)20)11(21)22/h3-5H,1-2H3,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | IPIHAHNHRJXWJM-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid?
The IUPAC name of 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid (CID 132516457) is 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid.
What is the SMILES notation for 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid?
The canonical SMILES for 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid is CC(C(=O)O)(C(=O)O)c1cccc(C(C)(C(=O)O)C(=O)O)n1.
What is the InChIKey of 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid?
The InChIKey is IPIHAHNHRJXWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO8/c1-12(8(15)16,9(17)18)6-4-3-5-7(14-6)13(2,10(19)20)11(21)22/h3-5H,1-2H3,(H,15,16)(H,17,18)(H,19,20)(H,21,22).
What are the key properties of 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid?
2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid has a molecular weight of 311.25 g/mol, XLogP of -0.06, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(1,1-dicarboxyethyl)-2-pyridinyl]-2-methylpropanedioic acid is sourced from PubChem (CID 132516457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).