C14H20O4 — CID 132517052
[(2S)-5-oxo-2H-pyran-2-yl] 3-cyclohexylpropanoate (PubChem CID 132517052) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is [(2S)-5-oxo-2H-pyran-2-yl] 3-cyclohexylpropanoate.
| Compound Name | [(2S)-5-oxo-2H-pyran-2-yl] 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 132517052 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [(2S)-5-oxo-2H-pyran-2-yl] 3-cyclohexylpropanoate |
| SMILES | O=C1C=C[C@H](OC(=O)CCC2CCCCC2)OC1 |
| InChI | InChI=1S/C14H20O4/c15-12-7-9-14(17-10-12)18-13(16)8-6-11-4-2-1-3-5-11/h7,9,11,14H,1-6,8,10H2/t14-/m0/s1 |
| InChIKey | YQUQTRJKJZBEDN-AWEZNQCLSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |