C22H26O6 — CID 134856984
[(2Z,5S)-3,14-dimethyl-7,13-dioxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[10.3.1.15,8]heptadeca-2,8(17),14-trien-1-yl] acetate (PubChem CID 134856984) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is [(2Z,5S)-3,14-dimethyl-7,13-dioxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[10.3.1.15,8]heptadeca-2,8(17),14-trien-1-yl] acetate.
| Compound Name | [(2Z,5S)-3,14-dimethyl-7,13-dioxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[10.3.1.15,8]heptadeca-2,8(17),14-trien-1-yl] acetate |
|---|---|
| PubChem CID | 134856984 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [(2Z,5S)-3,14-dimethyl-7,13-dioxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[10.3.1.15,8]heptadeca-2,8(17),14-trien-1-yl] acetate |
| SMILES | C=C(C)C1CCC2=C[C@H](C/C(C)=C\C3(OC(C)=O)C=C(C)C(=O)C1O3)OC2=O |
| InChI | InChI=1S/C22H26O6/c1-12(2)18-7-6-16-9-17(26-21(16)25)8-13(3)10-22(27-15(5)23)11-14(4)19(24)20(18)28-22/h9-11,17-18,20H,1,6-8H2,2-5H3/b13-10-/t17-,18?,20?,22?/m0/s1 |
| InChIKey | LQDXJWPNUXXCSH-WJZSIQRCSA-N |
| XLogP | 3.33 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|