C14H15N3O — CID 132518480
2-amino-4-phenyl-4,6,7,8-tetrahydro-1H-quinazolin-5-one (PubChem CID 132518480) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-amino-4-phenyl-4,6,7,8-tetrahydro-1H-quinazolin-5-one.
| Compound Name | 2-amino-4-phenyl-4,6,7,8-tetrahydro-1H-quinazolin-5-one |
|---|---|
| PubChem CID | 132518480 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-amino-4-phenyl-4,6,7,8-tetrahydro-1H-quinazolin-5-one |
| SMILES | NC1=NC(c2ccccc2)C2=C(CCCC2=O)N1 |
| InChI | InChI=1S/C14H15N3O/c15-14-16-10-7-4-8-11(18)12(10)13(17-14)9-5-2-1-3-6-9/h1-3,5-6,13H,4,7-8H2,(H3,15,16,17) |
| InChIKey | CNELWPJLGNANRD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |