C14H14N2O2 — CID 91083572
4-(3-hydroxyphenyl)-4,6,7,8-tetrahydro-1H-quinazolin-5-one (PubChem CID 91083572) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-4,6,7,8-tetrahydro-1H-quinazolin-5-one.
| Compound Name | 4-(3-hydroxyphenyl)-4,6,7,8-tetrahydro-1H-quinazolin-5-one |
|---|---|
| PubChem CID | 91083572 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-(3-hydroxyphenyl)-4,6,7,8-tetrahydro-1H-quinazolin-5-one |
| SMILES | O=C1CCCC2=C1C(c1cccc(O)c1)N=CN2 |
| InChI | InChI=1S/C14H14N2O2/c17-10-4-1-3-9(7-10)14-13-11(15-8-16-14)5-2-6-12(13)18/h1,3-4,7-8,14,17H,2,5-6H2,(H,15,16) |
| InChIKey | BTDFZQQBABCCDE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |