C16H20O6 — CID 132519201
(3R,6S,7R,8S,11R,12R,13R)-6,7-dihydroxy-3-methoxy-12-methyl-13-prop-1-en-2-yl-2,10-dioxatetracyclo[5.4.1.18,11.04,12]tridec-4-en-9-one (PubChem CID 132519201) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (3R,6S,7R,8S,11R,12R,13R)-6,7-dihydroxy-3-methoxy-12-methyl-13-prop-1-en-2-yl-2,10-dioxatetracyclo[5.4.1.18,11.04,12]tridec-4-en-9-one.
| Compound Name | (3R,6S,7R,8S,11R,12R,13R)-6,7-dihydroxy-3-methoxy-12-methyl-13-prop-1-en-2-yl-2,10-dioxatetracyclo[5.4.1.18,11.04,12]tridec-4-en-9-one |
|---|---|
| PubChem CID | 132519201 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3R,6S,7R,8S,11R,12R,13R)-6,7-dihydroxy-3-methoxy-12-methyl-13-prop-1-en-2-yl-2,10-dioxatetracyclo[5.4.1.18,11.04,12]tridec-4-en-9-one |
| SMILES | C=C(C)[C@@H]1[C@H]2OC(=O)[C@@H]1[C@]1(O)[C@@H](O)C=C3[C@H](OC)OC2[C@@]31C |
| InChI | InChI=1S/C16H20O6/c1-6(2)9-10-13(18)21-11(9)12-15(3)7(14(20-4)22-12)5-8(17)16(10,15)19/h5,8-12,14,17,19H,1H2,2-4H3/t8-,9-,10+,11+,12?,14+,15+,16+/m0/s1 |
| InChIKey | MPFVQTUWQUCGAI-RWMNFBRZSA-N |
| XLogP | 0.14 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|