C17H24O5S — CID 132521045
(2R,3S,4S,4aS,8S,8aR)-3,4,8-trimethoxy-2-phenylsulfanyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran (PubChem CID 132521045) has the molecular formula C17H24O5S and a molecular weight of 340.44 g/mol. Its IUPAC name is (2R,3S,4S,4aS,8S,8aR)-3,4,8-trimethoxy-2-phenylsulfanyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran.
| Compound Name | (2R,3S,4S,4aS,8S,8aR)-3,4,8-trimethoxy-2-phenylsulfanyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 132521045 |
| Molecular Formula | C17H24O5S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (2R,3S,4S,4aS,8S,8aR)-3,4,8-trimethoxy-2-phenylsulfanyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
| SMILES | CO[C@H]1[C@@H]2OCC[C@H](OC)[C@H]2O[C@H](Sc2ccccc2)[C@H]1OC |
| InChI | InChI=1S/C17H24O5S/c1-18-12-9-10-21-15-13(12)22-17(16(20-3)14(15)19-2)23-11-7-5-4-6-8-11/h4-8,12-17H,9-10H2,1-3H3/t12-,13+,14-,15+,16-,17+/m0/s1 |
| InChIKey | ZLOHAZQZFMDDRA-QROFKTNTSA-N |
| XLogP | 2.34 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |