C21H28N2O — CID 13252290
2-(2,6-diethylanilino)-N-(4-ethylphenyl)propanamide (PubChem CID 13252290) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-(2,6-diethylanilino)-N-(4-ethylphenyl)propanamide.
| Compound Name | 2-(2,6-diethylanilino)-N-(4-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 13252290 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 2-(2,6-diethylanilino)-N-(4-ethylphenyl)propanamide |
| SMILES | CCc1ccc(NC(=O)C(C)Nc2c(CC)cccc2CC)cc1 |
| InChI | InChI=1S/C21H28N2O/c1-5-16-11-13-19(14-12-16)23-21(24)15(4)22-20-17(6-2)9-8-10-18(20)7-3/h8-15,22H,5-7H2,1-4H3,(H,23,24) |
| InChIKey | IXPXQIXVJOXIDW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |