C25H29N3O — CID 4640614
N-(4-ethylphenyl)-2-[2-(2-phenylethylamino)anilino]propanamide (PubChem CID 4640614) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[2-(2-phenylethylamino)anilino]propanamide.
| Compound Name | N-(4-ethylphenyl)-2-[2-(2-phenylethylamino)anilino]propanamide |
|---|---|
| PubChem CID | 4640614 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-(4-ethylphenyl)-2-[2-(2-phenylethylamino)anilino]propanamide |
| SMILES | CCc1ccc(NC(=O)C(C)Nc2ccccc2NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H29N3O/c1-3-20-13-15-22(16-14-20)28-25(29)19(2)27-24-12-8-7-11-23(24)26-18-17-21-9-5-4-6-10-21/h4-16,19,26-27H,3,17-18H2,1-2H3,(H,28,29) |
| InChIKey | URXNPKBSEUBMHQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|