C8H11NO2 — CID 132524813
8a-hydroxy-5,6,7,8-tetrahydroindolizin-3-one (PubChem CID 132524813) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 8a-hydroxy-5,6,7,8-tetrahydroindolizin-3-one.
| Compound Name | 8a-hydroxy-5,6,7,8-tetrahydroindolizin-3-one |
|---|---|
| PubChem CID | 132524813 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 8a-hydroxy-5,6,7,8-tetrahydroindolizin-3-one |
| SMILES | O=C1C=CC2(O)CCCCN12 |
| InChI | InChI=1S/C8H11NO2/c10-7-3-5-8(11)4-1-2-6-9(7)8/h3,5,11H,1-2,4,6H2 |
| InChIKey | MJPNAFXIJCBHCB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |