C14H23NO2 — CID 132524818
5-hexyl-8a-hydroxy-5,6,7,8-tetrahydroindolizin-3-one (PubChem CID 132524818) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 5-hexyl-8a-hydroxy-5,6,7,8-tetrahydroindolizin-3-one.
| Compound Name | 5-hexyl-8a-hydroxy-5,6,7,8-tetrahydroindolizin-3-one |
|---|---|
| PubChem CID | 132524818 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 5-hexyl-8a-hydroxy-5,6,7,8-tetrahydroindolizin-3-one |
| SMILES | CCCCCCC1CCCC2(O)C=CC(=O)N12 |
| InChI | InChI=1S/C14H23NO2/c1-2-3-4-5-7-12-8-6-10-14(17)11-9-13(16)15(12)14/h9,11-12,17H,2-8,10H2,1H3 |
| InChIKey | DJFOCERIVGFXTO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|