C23H22O10S — CID 132525609
[(3aS,4S,9aS,9bR)-6-methyl-3-methylidene-2,7-dioxo-4-sulfooxy-4,5,9a,9b-tetrahydro-3aH-azuleno[8,7-b]furan-9-yl]methyl 2-(4-hydroxyphenyl)acetate (PubChem CID 132525609) has the molecular formula C23H22O10S and a molecular weight of 490.49 g/mol. Its IUPAC name is [(3aS,4S,9aS,9bR)-6-methyl-3-methylidene-2,7-dioxo-4-sulfooxy-4,5,9a,9b-tetrahydro-3aH-azuleno[8,7-b]furan-9-yl]methyl 2-(4-hydroxyphenyl)acetate.
| Compound Name | [(3aS,4S,9aS,9bR)-6-methyl-3-methylidene-2,7-dioxo-4-sulfooxy-4,5,9a,9b-tetrahydro-3aH-azuleno[8,7-b]furan-9-yl]methyl 2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 132525609 |
| Molecular Formula | C23H22O10S |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [(3aS,4S,9aS,9bR)-6-methyl-3-methylidene-2,7-dioxo-4-sulfooxy-4,5,9a,9b-tetrahydro-3aH-azuleno[8,7-b]furan-9-yl]methyl 2-(4-hydroxyphenyl)acetate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3C(COC(=O)Cc4ccc(O)cc4)=CC(=O)C3=C(C)C[C@H](OS(=O)(=O)O)[C@@H]12 |
| InChI | InChI=1S/C23H22O10S/c1-11-7-17(33-34(28,29)30)20-12(2)23(27)32-22(20)21-14(9-16(25)19(11)21)10-31-18(26)8-13-3-5-15(24)6-4-13/h3-6,9,17,20-22,24H,2,7-8,10H2,1H3,(H,28,29,30)/t17-,20+,21-,22-/m0/s1 |
| InChIKey | HAAFMPVLNFTPMR-XGARDCMYSA-N |
| XLogP | 1.61 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|