C15H16O7S — CID 132525610
[(3aS,9aS,9bS)-6-methyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[8,7-b]furan-9-yl]methyl hydrogen sulfate (PubChem CID 132525610) has the molecular formula C15H16O7S and a molecular weight of 340.35 g/mol. Its IUPAC name is [(3aS,9aS,9bS)-6-methyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[8,7-b]furan-9-yl]methyl hydrogen sulfate.
| Compound Name | [(3aS,9aS,9bS)-6-methyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[8,7-b]furan-9-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 132525610 |
| Molecular Formula | C15H16O7S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | [(3aS,9aS,9bS)-6-methyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[8,7-b]furan-9-yl]methyl hydrogen sulfate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3C(COS(=O)(=O)O)=CC(=O)C3=C(C)CC[C@@H]12 |
| InChI | InChI=1S/C15H16O7S/c1-7-3-4-10-8(2)15(17)22-14(10)13-9(5-11(16)12(7)13)6-21-23(18,19)20/h5,10,13-14H,2-4,6H2,1H3,(H,18,19,20)/t10-,13-,14-/m0/s1 |
| InChIKey | QHNIIDCKKSETDB-BPNCWPANSA-N |
| XLogP | 1.14 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|