About (5R)-1,10-dioxaspiro[4.5]decan-2-one
(5R)-1,10-dioxaspiro[4.5]decan-2-one (PubChem CID 132526223) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is (5R)-1,10-dioxaspiro[4.5]decan-2-one.
Molecular Properties
| Compound Name | (5R)-1,10-dioxaspiro[4.5]decan-2-one |
| PubChem CID | 132526223 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (5R)-1,10-dioxaspiro[4.5]decan-2-one |
| SMILES | O=C1CC[C@@]2(CCCCO2)O1 |
| InChI | InChI=1S/C8H12O3/c9-7-3-5-8(11-7)4-1-2-6-10-8/h1-6H2/t8-/m1/s1 |
| InChIKey | YFVHVXQMVVESQB-MRVPVSSYSA-N |
| XLogP | 1.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-1,10-dioxaspiro[4.5]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1,10-dioxaspiro[4.5]decan-2-one?
The IUPAC name of (5R)-1,10-dioxaspiro[4.5]decan-2-one (CID 132526223) is (5R)-1,10-dioxaspiro[4.5]decan-2-one.
What is the SMILES notation for (5R)-1,10-dioxaspiro[4.5]decan-2-one?
The canonical SMILES for (5R)-1,10-dioxaspiro[4.5]decan-2-one is O=C1CC[C@@]2(CCCCO2)O1.
What is the InChIKey of (5R)-1,10-dioxaspiro[4.5]decan-2-one?
The InChIKey is YFVHVXQMVVESQB-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H12O3/c9-7-3-5-8(11-7)4-1-2-6-10-8/h1-6H2/t8-/m1/s1.
What are the key properties of (5R)-1,10-dioxaspiro[4.5]decan-2-one?
(5R)-1,10-dioxaspiro[4.5]decan-2-one has a molecular weight of 156.18 g/mol, XLogP of 1.22, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1,10-dioxaspiro[4.5]decan-2-one is sourced from PubChem (CID 132526223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).