C37H45N3O — CID 132527173
N,N-bis[[(1S,3R,4R)-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]heptan-3-yl]methyl]benzamide (PubChem CID 132527173) has the molecular formula C37H45N3O and a molecular weight of 547.79 g/mol. Its IUPAC name is N,N-bis[[(1S,3R,4R)-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]heptan-3-yl]methyl]benzamide.
| Compound Name | N,N-bis[[(1S,3R,4R)-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]heptan-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 132527173 |
| Molecular Formula | C37H45N3O |
| Molecular Weight | 547.79 g/mol |
| Exact Mass | 547.36 |
| IUPAC Name | N,N-bis[[(1S,3R,4R)-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]heptan-3-yl]methyl]benzamide |
| SMILES | C[C@@H](c1ccccc1)N1[C@H]2CC[C@H](C2)[C@@H]1CN(C[C@H]1[C@@H]2CC[C@@H](C2)N1[C@@H](C)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C37H45N3O/c1-26(28-12-6-3-7-13-28)39-33-20-18-31(22-33)35(39)24-38(37(41)30-16-10-5-11-17-30)25-36-32-19-21-34(23-32)40(36)27(2)29-14-8-4-9-15-29/h3-17,26-27,31-36H,18-25H2,1-2H3/t26-,27-,31+,32+,33-,34-,35-,36-/m0/s1 |
| InChIKey | BSUXPSPGSACBDD-ZVNXMCHMSA-N |
| XLogP | 7.36 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.79 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |