C21H28F2 — CID 132528098
2-[(1E,3E,5E,7E)-10,10-difluoro-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene (PubChem CID 132528098) has the molecular formula C21H28F2 and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-10,10-difluoro-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E)-10,10-difluoro-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 132528098 |
| Molecular Formula | C21H28F2 |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-10,10-difluoro-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C(F)F)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H28F2/c1-16(8-6-9-17(2)12-14-20(22)23)11-13-19-18(3)10-7-15-21(19,4)5/h6,8-9,11-14H,7,10,15H2,1-5H3/b9-6+,13-11+,16-8+,17-12+ |
| InChIKey | IRBOHBRDJXUOKE-QHGFFOOUSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|