C20H14ClN3O — CID 132528901
N-(4-chlorophenyl)-2-imidazo[1,2-a]pyridin-2-ylbenzamide (PubChem CID 132528901) has the molecular formula C20H14ClN3O and a molecular weight of 347.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-imidazo[1,2-a]pyridin-2-ylbenzamide.
| Compound Name | N-(4-chlorophenyl)-2-imidazo[1,2-a]pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 132528901 |
| Molecular Formula | C20H14ClN3O |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-imidazo[1,2-a]pyridin-2-ylbenzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccccc1-c1cn2ccccc2n1 |
| InChI | InChI=1S/C20H14ClN3O/c21-14-8-10-15(11-9-14)22-20(25)17-6-2-1-5-16(17)18-13-24-12-4-3-7-19(24)23-18/h1-13H,(H,22,25) |
| InChIKey | GCNMORXHRBTNRH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |