C15H13N3O — CID 121148942
N-(2-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide (PubChem CID 121148942) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is N-(2-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide.
| Compound Name | N-(2-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 121148942 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | N-(2-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide |
| SMILES | CC(=O)Nc1ccccc1-c1cn2ccccc2n1 |
| InChI | InChI=1S/C15H13N3O/c1-11(19)16-13-7-3-2-6-12(13)14-10-18-9-5-4-8-15(18)17-14/h2-10H,1H3,(H,16,19) |
| InChIKey | VEGUPFMIRSAVNX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |