C18H13N3O2 — CID 121149015
N-(2-imidazo[1,2-a]pyridin-2-ylphenyl)furan-3-carboxamide (PubChem CID 121149015) has the molecular formula C18H13N3O2 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-(2-imidazo[1,2-a]pyridin-2-ylphenyl)furan-3-carboxamide.
| Compound Name | N-(2-imidazo[1,2-a]pyridin-2-ylphenyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 121149015 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(2-imidazo[1,2-a]pyridin-2-ylphenyl)furan-3-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1cn2ccccc2n1)c1ccoc1 |
| InChI | InChI=1S/C18H13N3O2/c22-18(13-8-10-23-12-13)20-15-6-2-1-5-14(15)16-11-21-9-4-3-7-17(21)19-16/h1-12H,(H,20,22) |
| InChIKey | VCQIDDZMBDBSRW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |