C21H17N3O4S — CID 121149702
methyl 4-[(2-imidazo[1,2-a]pyridin-2-ylphenyl)sulfamoyl]benzoate (PubChem CID 121149702) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is methyl 4-[(2-imidazo[1,2-a]pyridin-2-ylphenyl)sulfamoyl]benzoate.
| Compound Name | methyl 4-[(2-imidazo[1,2-a]pyridin-2-ylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 121149702 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | methyl 4-[(2-imidazo[1,2-a]pyridin-2-ylphenyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)Nc2ccccc2-c2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C21H17N3O4S/c1-28-21(25)15-9-11-16(12-10-15)29(26,27)23-18-7-3-2-6-17(18)19-14-24-13-5-4-8-20(24)22-19/h2-14,23H,1H3 |
| InChIKey | OWVHJBRPFFYLNX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |