C15H26O — CID 132529865
(2E)-1-cyclohexyl-2-ethyl-3,4-dimethylpenta-2,4-dien-1-ol (PubChem CID 132529865) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (2E)-1-cyclohexyl-2-ethyl-3,4-dimethylpenta-2,4-dien-1-ol.
| Compound Name | (2E)-1-cyclohexyl-2-ethyl-3,4-dimethylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 132529865 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (2E)-1-cyclohexyl-2-ethyl-3,4-dimethylpenta-2,4-dien-1-ol |
| SMILES | C=C(C)/C(C)=C(\CC)C(O)C1CCCCC1 |
| InChI | InChI=1S/C15H26O/c1-5-14(12(4)11(2)3)15(16)13-9-7-6-8-10-13/h13,15-16H,2,5-10H2,1,3-4H3/b14-12+ |
| InChIKey | KDGQNHOWVVKWDG-WYMLVPIESA-N |
| XLogP | 4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|