C17H19NS — CID 132530725
5-(1-phenylbut-3-enyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 132530725) has the molecular formula C17H19NS and a molecular weight of 269.41 g/mol. Its IUPAC name is 5-(1-phenylbut-3-enyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-(1-phenylbut-3-enyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 132530725 |
| Molecular Formula | C17H19NS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5-(1-phenylbut-3-enyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | C=CCC(c1ccccc1)N1CCc2sccc2C1 |
| InChI | InChI=1S/C17H19NS/c1-2-6-16(14-7-4-3-5-8-14)18-11-9-17-15(13-18)10-12-19-17/h2-5,7-8,10,12,16H,1,6,9,11,13H2 |
| InChIKey | HEFIQASLMRRCDT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|