C15H20O6S — CID 132531053
ethyl 2-(2,4-dimethylphenyl)sulfonyloxy-2-methyl-3-oxobutanoate (PubChem CID 132531053) has the molecular formula C15H20O6S and a molecular weight of 328.39 g/mol. Its IUPAC name is ethyl 2-(2,4-dimethylphenyl)sulfonyloxy-2-methyl-3-oxobutanoate.
| Compound Name | ethyl 2-(2,4-dimethylphenyl)sulfonyloxy-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 132531053 |
| Molecular Formula | C15H20O6S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | ethyl 2-(2,4-dimethylphenyl)sulfonyloxy-2-methyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(OS(=O)(=O)c1ccc(C)cc1C)C(C)=O |
| InChI | InChI=1S/C15H20O6S/c1-6-20-14(17)15(5,12(4)16)21-22(18,19)13-8-7-10(2)9-11(13)3/h7-9H,6H2,1-5H3 |
| InChIKey | XVMDZERKVLNXQI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|