C18H16ClNO3 — CID 132533045
(E,3S)-1-(3-chlorophenyl)-3-(nitromethyl)-5-phenylpent-4-en-1-one (PubChem CID 132533045) has the molecular formula C18H16ClNO3 and a molecular weight of 329.78 g/mol. Its IUPAC name is (E,3S)-1-(3-chlorophenyl)-3-(nitromethyl)-5-phenylpent-4-en-1-one.
| Compound Name | (E,3S)-1-(3-chlorophenyl)-3-(nitromethyl)-5-phenylpent-4-en-1-one |
|---|---|
| PubChem CID | 132533045 |
| Molecular Formula | C18H16ClNO3 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (E,3S)-1-(3-chlorophenyl)-3-(nitromethyl)-5-phenylpent-4-en-1-one |
| SMILES | O=C(C[C@@H](/C=C/c1ccccc1)C[N+](=O)[O-])c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16ClNO3/c19-17-8-4-7-16(12-17)18(21)11-15(13-20(22)23)10-9-14-5-2-1-3-6-14/h1-10,12,15H,11,13H2/b10-9+/t15-/m1/s1 |
| InChIKey | XQXCQMFPPGIHDS-BOLDSZDNSA-N |
| XLogP | 4.52 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|