C18H15ClN2O5 — CID 132533050
(E,3S)-1-(4-chlorophenyl)-3-(nitromethyl)-5-(4-nitrophenyl)pent-4-en-1-one (PubChem CID 132533050) has the molecular formula C18H15ClN2O5 and a molecular weight of 374.78 g/mol. Its IUPAC name is (E,3S)-1-(4-chlorophenyl)-3-(nitromethyl)-5-(4-nitrophenyl)pent-4-en-1-one.
| Compound Name | (E,3S)-1-(4-chlorophenyl)-3-(nitromethyl)-5-(4-nitrophenyl)pent-4-en-1-one |
|---|---|
| PubChem CID | 132533050 |
| Molecular Formula | C18H15ClN2O5 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (E,3S)-1-(4-chlorophenyl)-3-(nitromethyl)-5-(4-nitrophenyl)pent-4-en-1-one |
| SMILES | O=C(C[C@@H](/C=C/c1ccc([N+](=O)[O-])cc1)C[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClN2O5/c19-16-7-5-15(6-8-16)18(22)11-14(12-20(23)24)2-1-13-3-9-17(10-4-13)21(25)26/h1-10,14H,11-12H2/b2-1+/t14-/m1/s1 |
| InChIKey | VJRTXBYLQSNRHJ-VSZDKKFSSA-N |
| XLogP | 4.43 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|