C17H15NO — CID 132534099
[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-quinolin-8-ylmethanone (PubChem CID 132534099) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-quinolin-8-ylmethanone.
| Compound Name | [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-quinolin-8-ylmethanone |
|---|---|
| PubChem CID | 132534099 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-quinolin-8-ylmethanone |
| SMILES | O=C(c1cccc2cccnc12)[C@@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C17H15NO/c19-17(15-10-11-6-7-13(15)9-11)14-5-1-3-12-4-2-8-18-16(12)14/h1-8,11,13,15H,9-10H2/t11-,13+,15+/m0/s1 |
| InChIKey | DEBDBNFJTZVAJS-NJZAAPMLSA-N |
| XLogP | 3.63 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|