C17H18ClNO4 — CID 132534434
ethyl 1-tert-butyl-4-(3-chlorophenyl)-2,5-dioxopyrrole-3-carboxylate (PubChem CID 132534434) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is ethyl 1-tert-butyl-4-(3-chlorophenyl)-2,5-dioxopyrrole-3-carboxylate.
| Compound Name | ethyl 1-tert-butyl-4-(3-chlorophenyl)-2,5-dioxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 132534434 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | ethyl 1-tert-butyl-4-(3-chlorophenyl)-2,5-dioxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2cccc(Cl)c2)C(=O)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H18ClNO4/c1-5-23-16(22)13-12(10-7-6-8-11(18)9-10)14(20)19(15(13)21)17(2,3)4/h6-9H,5H2,1-4H3 |
| InChIKey | ZZRMZQUMLVRZDN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|