C18H18F3NO4 — CID 132534432
ethyl 1-tert-butyl-2,5-dioxo-4-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate (PubChem CID 132534432) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is ethyl 1-tert-butyl-2,5-dioxo-4-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 1-tert-butyl-2,5-dioxo-4-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 132534432 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | ethyl 1-tert-butyl-2,5-dioxo-4-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccc(C(F)(F)F)cc2)C(=O)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H18F3NO4/c1-5-26-16(25)13-12(14(23)22(15(13)24)17(2,3)4)10-6-8-11(9-7-10)18(19,20)21/h6-9H,5H2,1-4H3 |
| InChIKey | MZEUBEWNTPRVMV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|