About dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate
dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate (PubChem CID 102187381) has the molecular formula C22H29NO6
and a molecular weight of 403.48 g/mol. Its IUPAC name is dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate.
Molecular Properties
| Compound Name | dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate |
| PubChem CID | 102187381 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate |
| SMILES | CC(C)OC(=O)/C=C(/C(=O)OC(C)C)C(=O)N(C(=O)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H29NO6/c1-14(2)28-18(24)13-17(21(27)29-15(3)4)20(26)23(22(5,6)7)19(25)16-11-9-8-10-12-16/h8-15H,1-7H3/b17-13+ |
| InChIKey | UQDQGNROCLARLC-GHRIWEEISA-N |
| XLogP | 3.28 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate?
The IUPAC name of dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate (CID 102187381) is dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate.
What is the SMILES notation for dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate?
The canonical SMILES for dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate is CC(C)OC(=O)/C=C(/C(=O)OC(C)C)C(=O)N(C(=O)c1ccccc1)C(C)(C)C.
What is the InChIKey of dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate?
The InChIKey is UQDQGNROCLARLC-GHRIWEEISA-N. The full InChI is InChI=1S/C22H29NO6/c1-14(2)28-18(24)13-17(21(27)29-15(3)4)20(26)23(22(5,6)7)19(25)16-11-9-8-10-12-16/h8-15H,1-7H3/b17-13+.
What are the key properties of dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate?
dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate has a molecular weight of 403.48 g/mol, XLogP of 3.28, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl (E)-2-[benzoyl(tert-butyl)carbamoyl]but-2-enedioate is sourced from PubChem (CID 102187381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).