C17H17F6NO3 — CID 14939061
butyl 3-benzamido-4,4,4-trifluoro-2-methylidene-3-(trifluoromethyl)butanoate (PubChem CID 14939061) has the molecular formula C17H17F6NO3 and a molecular weight of 397.32 g/mol. Its IUPAC name is butyl 3-benzamido-4,4,4-trifluoro-2-methylidene-3-(trifluoromethyl)butanoate.
| Compound Name | butyl 3-benzamido-4,4,4-trifluoro-2-methylidene-3-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 14939061 |
| Molecular Formula | C17H17F6NO3 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | butyl 3-benzamido-4,4,4-trifluoro-2-methylidene-3-(trifluoromethyl)butanoate |
| SMILES | C=C(C(=O)OCCCC)C(NC(=O)c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H17F6NO3/c1-3-4-10-27-14(26)11(2)15(16(18,19)20,17(21,22)23)24-13(25)12-8-6-5-7-9-12/h5-9H,2-4,10H2,1H3,(H,24,25) |
| InChIKey | ZGURVDZWPQBKEN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|