C20H23NO6 — CID 25017430
dimethyl (E)-2-[benzoyl(cyclohexyl)carbamoyl]but-2-enedioate (PubChem CID 25017430) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is dimethyl (E)-2-[benzoyl(cyclohexyl)carbamoyl]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[benzoyl(cyclohexyl)carbamoyl]but-2-enedioate |
|---|---|
| PubChem CID | 25017430 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | dimethyl (E)-2-[benzoyl(cyclohexyl)carbamoyl]but-2-enedioate |
| SMILES | COC(=O)/C=C(/C(=O)OC)C(=O)N(C(=O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H23NO6/c1-26-17(22)13-16(20(25)27-2)19(24)21(15-11-7-4-8-12-15)18(23)14-9-5-3-6-10-14/h3,5-6,9-10,13,15H,4,7-8,11-12H2,1-2H3/b16-13+ |
| InChIKey | MVPSJMYLRMZIGV-DTQAZKPQSA-N |
| XLogP | 2.26 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|