C16H20N2O4 — CID 5271084
ethyl (E,4S)-7-amino-4-benzamido-7-oxohept-2-enoate (PubChem CID 5271084) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-4-benzamido-7-oxohept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-4-benzamido-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 5271084 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | ethyl (E,4S)-7-amino-4-benzamido-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O4/c1-2-22-15(20)11-9-13(8-10-14(17)19)18-16(21)12-6-4-3-5-7-12/h3-7,9,11,13H,2,8,10H2,1H3,(H2,17,19)(H,18,21)/b11-9+/t13-/m0/s1 |
| InChIKey | AWFSWBKCNKQDQU-STRFDMGBSA-N |
| XLogP | 1.17 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|