About cyanomethyl 2-benzamidopropanoate
cyanomethyl 2-benzamidopropanoate (PubChem CID 21323655) has the molecular formula C12H12N2O3
and a molecular weight of 232.24 g/mol. Its IUPAC name is cyanomethyl 2-benzamidopropanoate.
Molecular Properties
| Compound Name | cyanomethyl 2-benzamidopropanoate |
| PubChem CID | 21323655 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | cyanomethyl 2-benzamidopropanoate |
| SMILES | CC(NC(=O)c1ccccc1)C(=O)OCC#N |
| InChI | InChI=1S/C12H12N2O3/c1-9(12(16)17-8-7-13)14-11(15)10-5-3-2-4-6-10/h2-6,9H,8H2,1H3,(H,14,15) |
| InChIKey | PWCDDQPGYUKJMJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyanomethyl 2-benzamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl 2-benzamidopropanoate?
The IUPAC name of cyanomethyl 2-benzamidopropanoate (CID 21323655) is cyanomethyl 2-benzamidopropanoate.
What is the SMILES notation for cyanomethyl 2-benzamidopropanoate?
The canonical SMILES for cyanomethyl 2-benzamidopropanoate is CC(NC(=O)c1ccccc1)C(=O)OCC#N.
What is the InChIKey of cyanomethyl 2-benzamidopropanoate?
The InChIKey is PWCDDQPGYUKJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-9(12(16)17-8-7-13)14-11(15)10-5-3-2-4-6-10/h2-6,9H,8H2,1H3,(H,14,15).
What are the key properties of cyanomethyl 2-benzamidopropanoate?
cyanomethyl 2-benzamidopropanoate has a molecular weight of 232.24 g/mol, XLogP of 0.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 2-benzamidopropanoate is sourced from PubChem (CID 21323655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).