About Hippuric Acid
Hippuric Acid (PubChem CID 464) has the molecular formula C9H9NO3
and a molecular weight of 179.17 g/mol. Its IUPAC name is 2-benzamidoacetic acid.
Molecular Properties
| Compound Name | Hippuric Acid |
| PubChem CID | 464 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 2-benzamidoacetic acid |
| SMILES | C1=CC=C(C=C1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12) |
| InChIKey | QIAFMBKCNZACKA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 197 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Hippuric Acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hippuric Acid?
The IUPAC name of Hippuric Acid (CID 464) is 2-benzamidoacetic acid.
What is the SMILES notation for Hippuric Acid?
The canonical SMILES for Hippuric Acid is C1=CC=C(C=C1)C(=O)NCC(=O)O.
What is the InChIKey of Hippuric Acid?
The InChIKey is QIAFMBKCNZACKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12).
What are the key properties of Hippuric Acid?
Hippuric Acid has a molecular weight of 179.17 g/mol, XLogP of 0.30, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Hippuric Acid is sourced from PubChem (CID 464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).