About 2-benzamidoacetic acid
2-benzamidoacetic acid (PubChem CID 464) has the molecular formula C9H9NO3
and a molecular weight of 179.17 g/mol. Its IUPAC name is 2-benzamidoacetic acid.
Molecular Properties
| Compound Name | 2-benzamidoacetic acid |
| PubChem CID | 464 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 2-benzamidoacetic acid |
| SMILES | O=C(O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12) |
| InChIKey | QIAFMBKCNZACKA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzamidoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamidoacetic acid?
The IUPAC name of 2-benzamidoacetic acid (CID 464) is 2-benzamidoacetic acid.
What is the SMILES notation for 2-benzamidoacetic acid?
The canonical SMILES for 2-benzamidoacetic acid is O=C(O)CNC(=O)c1ccccc1.
What is the InChIKey of 2-benzamidoacetic acid?
The InChIKey is QIAFMBKCNZACKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12).
What are the key properties of 2-benzamidoacetic acid?
2-benzamidoacetic acid has a molecular weight of 179.17 g/mol, XLogP of 0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamidoacetic acid is sourced from PubChem (CID 464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).