C24H22ClN3Si — CID 132535846
2-[6-(4-chlorophenyl)-2-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]ethynyl-trimethylsilane (PubChem CID 132535846) has the molecular formula C24H22ClN3Si and a molecular weight of 416.00 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)-2-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[6-(4-chlorophenyl)-2-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 132535846 |
| Molecular Formula | C24H22ClN3Si |
| Molecular Weight | 416.00 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[6-(4-chlorophenyl)-2-(4-methylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]ethynyl-trimethylsilane |
| SMILES | Cc1ccc(-c2cc3ncc(-c4ccc(Cl)cc4)c(C#C[Si](C)(C)C)n3n2)cc1 |
| InChI | InChI=1S/C24H22ClN3Si/c1-17-5-7-19(8-6-17)22-15-24-26-16-21(18-9-11-20(25)12-10-18)23(28(24)27-22)13-14-29(2,3)4/h5-12,15-16H,1-4H3 |
| InChIKey | YGHGVUFBKPHUDY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.00 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|