C27H29NO7 — CID 132537028
4-O,4-O'-diethyl 6-O-methyl (3aR,9aS)-2-benzyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4,6-tricarboxylate (PubChem CID 132537028) has the molecular formula C27H29NO7 and a molecular weight of 479.53 g/mol. Its IUPAC name is 4-O,4-O'-diethyl 6-O-methyl (3aR,9aS)-2-benzyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4,6-tricarboxylate.
| Compound Name | 4-O,4-O'-diethyl 6-O-methyl (3aR,9aS)-2-benzyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4,6-tricarboxylate |
|---|---|
| PubChem CID | 132537028 |
| Molecular Formula | C27H29NO7 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 4-O,4-O'-diethyl 6-O-methyl (3aR,9aS)-2-benzyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4,6-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2cc(C(=O)OC)ccc2C[C@@H]2CN(Cc3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C27H29NO7/c1-4-34-25(31)27(26(32)35-5-2)21-14-19(24(30)33-3)12-11-18(21)13-20-16-28(23(29)22(20)27)15-17-9-7-6-8-10-17/h6-12,14,20,22H,4-5,13,15-16H2,1-3H3/t20-,22+/m1/s1 |
| InChIKey | CSBIDQXJSPBYTB-IRLDBZIGSA-N |
| XLogP | 2.67 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|