C27H28F3NO5 — CID 162400619
diethyl (3aR,9R,9aS)-2-benzyl-9-methyl-3-oxo-6-(trifluoromethyl)-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate (PubChem CID 162400619) has the molecular formula C27H28F3NO5 and a molecular weight of 503.52 g/mol. Its IUPAC name is diethyl (3aR,9R,9aS)-2-benzyl-9-methyl-3-oxo-6-(trifluoromethyl)-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate.
| Compound Name | diethyl (3aR,9R,9aS)-2-benzyl-9-methyl-3-oxo-6-(trifluoromethyl)-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
|---|---|
| PubChem CID | 162400619 |
| Molecular Formula | C27H28F3NO5 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | diethyl (3aR,9R,9aS)-2-benzyl-9-methyl-3-oxo-6-(trifluoromethyl)-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2cc(C(F)(F)F)ccc2[C@H](C)[C@@H]2CN(Cc3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C27H28F3NO5/c1-4-35-24(33)26(25(34)36-5-2)21-13-18(27(28,29)30)11-12-19(21)16(3)20-15-31(23(32)22(20)26)14-17-9-7-6-8-10-17/h6-13,16,20,22H,4-5,14-15H2,1-3H3/t16-,20-,22-/m0/s1 |
| InChIKey | HPZUAYMDCPVCLI-BUKVSMQUSA-N |
| XLogP | 4.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|