C33H29F6NO5 — CID 177439326
diethyl (3aS,4S,9aR)-2-benzyl-1-oxo-6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]-3,3a,4,9a-tetrahydrobenzo[f]isoindole-9,9-dicarboxylate (PubChem CID 177439326) has the molecular formula C33H29F6NO5 and a molecular weight of 633.59 g/mol. Its IUPAC name is diethyl (3aS,4S,9aR)-2-benzyl-1-oxo-6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]-3,3a,4,9a-tetrahydrobenzo[f]isoindole-9,9-dicarboxylate.
| Compound Name | diethyl (3aS,4S,9aR)-2-benzyl-1-oxo-6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]-3,3a,4,9a-tetrahydrobenzo[f]isoindole-9,9-dicarboxylate |
|---|---|
| PubChem CID | 177439326 |
| Molecular Formula | C33H29F6NO5 |
| Molecular Weight | 633.59 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | diethyl (3aS,4S,9aR)-2-benzyl-1-oxo-6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]-3,3a,4,9a-tetrahydrobenzo[f]isoindole-9,9-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2ccc(C(F)(F)F)cc2[C@H](c2cccc(C(F)(F)F)c2)[C@@H]2CN(Cc3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C33H29F6NO5/c1-3-44-29(42)31(30(43)45-4-2)25-14-13-22(33(37,38)39)16-23(25)26(20-11-8-12-21(15-20)32(34,35)36)24-18-40(28(41)27(24)31)17-19-9-6-5-7-10-19/h5-16,24,26-27H,3-4,17-18H2,1-2H3/t24-,26-,27-/m0/s1 |
| InChIKey | CSVKPNCVULIVME-URORMMCBSA-N |
| XLogP | 6.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|