C26H18NO4- — CID 6968355
(15R,19R)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylate (PubChem CID 6968355) has the molecular formula C26H18NO4- and a molecular weight of 408.43 g/mol. Its IUPAC name is (15R,19R)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylate.
| Compound Name | (15R,19R)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylate |
|---|---|
| PubChem CID | 6968355 |
| Molecular Formula | C26H18NO4- |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (15R,19R)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylate |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(C(=O)[O-])(c4ccccc43)[C@@H]2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H19NO4/c28-23-21-20-16-10-4-6-12-18(16)26(25(30)31,19-13-7-5-11-17(19)20)22(21)24(29)27(23)14-15-8-2-1-3-9-15/h1-13,20-22H,14H2,(H,30,31)/p-1/t20?,21-,22+,26?/m1/s1 |
| InChIKey | RREDHICTOYVTIE-YPHDTHBOSA-M |
| XLogP | 1.98 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|