C31H30FNO5 — CID 177495712
diethyl (3aS,9S,9aS)-2-benzyl-9-(4-fluorophenyl)-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate (PubChem CID 177495712) has the molecular formula C31H30FNO5 and a molecular weight of 515.58 g/mol. Its IUPAC name is diethyl (3aS,9S,9aS)-2-benzyl-9-(4-fluorophenyl)-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate.
| Compound Name | diethyl (3aS,9S,9aS)-2-benzyl-9-(4-fluorophenyl)-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
|---|---|
| PubChem CID | 177495712 |
| Molecular Formula | C31H30FNO5 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | diethyl (3aS,9S,9aS)-2-benzyl-9-(4-fluorophenyl)-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2ccccc2[C@H](c2ccc(F)cc2)[C@@H]2CN(Cc3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C31H30FNO5/c1-3-37-29(35)31(30(36)38-4-2)25-13-9-8-12-23(25)26(21-14-16-22(32)17-15-21)24-19-33(28(34)27(24)31)18-20-10-6-5-7-11-20/h5-17,24,26-27H,3-4,18-19H2,1-2H3/t24-,26-,27+/m0/s1 |
| InChIKey | KCRRSIXZKOKAMW-DOEKTCAHSA-N |
| XLogP | 4.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|