C25H26BrNO5 — CID 162400623
diethyl (3aR,9S,9aR)-2-benzyl-9-bromo-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate (PubChem CID 162400623) has the molecular formula C25H26BrNO5 and a molecular weight of 500.39 g/mol. Its IUPAC name is diethyl (3aR,9S,9aR)-2-benzyl-9-bromo-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate.
| Compound Name | diethyl (3aR,9S,9aR)-2-benzyl-9-bromo-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
|---|---|
| PubChem CID | 162400623 |
| Molecular Formula | C25H26BrNO5 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | diethyl (3aR,9S,9aR)-2-benzyl-9-bromo-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2ccccc2[C@@H](Br)[C@H]2CN(Cc3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C25H26BrNO5/c1-3-31-23(29)25(24(30)32-4-2)19-13-9-8-12-17(19)21(26)18-15-27(22(28)20(18)25)14-16-10-6-5-7-11-16/h5-13,18,20-21H,3-4,14-15H2,1-2H3/t18-,20-,21+/m0/s1 |
| InChIKey | AHXWWLKHNZNGKI-SESVDKBCSA-N |
| XLogP | 3.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|