C22H23BrN2 — CID 132537250
N-(4-bromophenyl)-N'-methyl-N'-(4-methylphenyl)-1-phenylethane-1,2-diamine (PubChem CID 132537250) has the molecular formula C22H23BrN2 and a molecular weight of 395.34 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-methyl-N'-(4-methylphenyl)-1-phenylethane-1,2-diamine.
| Compound Name | N-(4-bromophenyl)-N'-methyl-N'-(4-methylphenyl)-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 132537250 |
| Molecular Formula | C22H23BrN2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-(4-bromophenyl)-N'-methyl-N'-(4-methylphenyl)-1-phenylethane-1,2-diamine |
| SMILES | Cc1ccc(N(C)CC(Nc2ccc(Br)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23BrN2/c1-17-8-14-21(15-9-17)25(2)16-22(18-6-4-3-5-7-18)24-20-12-10-19(23)11-13-20/h3-15,22,24H,16H2,1-2H3 |
| InChIKey | FCGKNIKQNTWSOA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|