C17H18N2 — CID 64536950
3-(N,4-dimethylanilino)-2-phenylpropanenitrile (PubChem CID 64536950) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-(N,4-dimethylanilino)-2-phenylpropanenitrile.
| Compound Name | 3-(N,4-dimethylanilino)-2-phenylpropanenitrile |
|---|---|
| PubChem CID | 64536950 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-(N,4-dimethylanilino)-2-phenylpropanenitrile |
| SMILES | Cc1ccc(N(C)CC(C#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N2/c1-14-8-10-17(11-9-14)19(2)13-16(12-18)15-6-4-3-5-7-15/h3-11,16H,13H2,1-2H3 |
| InChIKey | RZYRPLNLOXNIJM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|