C30H50O4 — CID 132538117
(E,6R)-6-[(3S,5S,8S,9R,10S,13R,14S,17R)-3,9-dihydroxy-4,4,10,13,14-pentamethyl-1,2,3,5,6,7,8,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid (PubChem CID 132538117) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is (E,6R)-6-[(3S,5S,8S,9R,10S,13R,14S,17R)-3,9-dihydroxy-4,4,10,13,14-pentamethyl-1,2,3,5,6,7,8,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid.
| Compound Name | (E,6R)-6-[(3S,5S,8S,9R,10S,13R,14S,17R)-3,9-dihydroxy-4,4,10,13,14-pentamethyl-1,2,3,5,6,7,8,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 132538117 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | (E,6R)-6-[(3S,5S,8S,9R,10S,13R,14S,17R)-3,9-dihydroxy-4,4,10,13,14-pentamethyl-1,2,3,5,6,7,8,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |
| SMILES | C/C(=C\CC[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)[C@@]3(O)CC[C@]12C)C(=O)O |
| InChI | InChI=1S/C30H50O4/c1-19(9-8-10-20(2)25(32)33)21-13-15-28(6)23-12-11-22-26(3,4)24(31)14-16-29(22,7)30(23,34)18-17-27(21,28)5/h10,19,21-24,31,34H,8-9,11-18H2,1-7H3,(H,32,33)/b20-10+/t19-,21-,22+,23+,24+,27-,28+,29+,30-/m1/s1 |
| InChIKey | HOVPCEVGONQQPM-UDSFCTQPSA-N |
| XLogP | 6.59 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|